C21H15F3N2O2S2 — CID 141164267
5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-1-[2-(trifluoromethyl)phenyl]pyrazole (PubChem CID 141164267) has the molecular formula C21H15F3N2O2S2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-1-[2-(trifluoromethyl)phenyl]pyrazole.
| Compound Name | 5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-1-[2-(trifluoromethyl)phenyl]pyrazole |
|---|---|
| PubChem CID | 141164267 |
| Molecular Formula | C21H15F3N2O2S2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-1-[2-(trifluoromethyl)phenyl]pyrazole |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(-c3ccnn3-c3ccccc3C(F)(F)F)s2)c1 |
| InChI | InChI=1S/C21H15F3N2O2S2/c1-30(27,28)15-6-4-5-14(13-15)19-9-10-20(29-19)18-11-12-25-26(18)17-8-3-2-7-16(17)21(22,23)24/h2-13H,1H3 |
| InChIKey | BQUZLQFVSGDZQX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |