C19H14FN3O2S2 — CID 141164262
3-fluoro-4-[5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrazol-1-yl]pyridine (PubChem CID 141164262) has the molecular formula C19H14FN3O2S2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-fluoro-4-[5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrazol-1-yl]pyridine.
| Compound Name | 3-fluoro-4-[5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrazol-1-yl]pyridine |
|---|---|
| PubChem CID | 141164262 |
| Molecular Formula | C19H14FN3O2S2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 3-fluoro-4-[5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]pyrazol-1-yl]pyridine |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(-c3ccnn3-c3ccncc3F)s2)c1 |
| InChI | InChI=1S/C19H14FN3O2S2/c1-27(24,25)14-4-2-3-13(11-14)18-5-6-19(26-18)17-8-10-22-23(17)16-7-9-21-12-15(16)20/h2-12H,1H3 |
| InChIKey | WIGMGTPDKLXOHP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |