C16H19N3O2S — CID 19089225
1,1-dimethyl-2-[2-(3-methylsulfonylphenyl)phenyl]guanidine (PubChem CID 19089225) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1,1-dimethyl-2-[2-(3-methylsulfonylphenyl)phenyl]guanidine.
| Compound Name | 1,1-dimethyl-2-[2-(3-methylsulfonylphenyl)phenyl]guanidine |
|---|---|
| PubChem CID | 19089225 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1,1-dimethyl-2-[2-(3-methylsulfonylphenyl)phenyl]guanidine |
| SMILES | CN(C)/C(N)=N/c1ccccc1-c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H19N3O2S/c1-19(2)16(17)18-15-10-5-4-9-14(15)12-7-6-8-13(11-12)22(3,20)21/h4-11H,1-3H3,(H2,17,18) |
| InChIKey | YKYSIRVYPPGALJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|