C16H14N4O2S — CID 53353331
6-(3-methylsulfonylphenyl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 53353331) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is 6-(3-methylsulfonylphenyl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(3-methylsulfonylphenyl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 53353331 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 6-(3-methylsulfonylphenyl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | CS(=O)(=O)c1cccc(-c2nnc(N)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C16H14N4O2S/c1-23(21,22)13-9-5-8-12(10-13)15-14(18-16(17)20-19-15)11-6-3-2-4-7-11/h2-10H,1H3,(H2,17,18,20) |
| InChIKey | FEMQVXAYCFTNLT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |