C18H14N6 — CID 135234262
6-(4-methylquinazolin-6-yl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 135234262) has the molecular formula C18H14N6 and a molecular weight of 314.35 g/mol. Its IUPAC name is 6-(4-methylquinazolin-6-yl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(4-methylquinazolin-6-yl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 135234262 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 6-(4-methylquinazolin-6-yl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Cc1ncnc2ccc(-c3nnc(N)nc3-c3ccccc3)cc12 |
| InChI | InChI=1S/C18H14N6/c1-11-14-9-13(7-8-15(14)21-10-20-11)17-16(22-18(19)24-23-17)12-5-3-2-4-6-12/h2-10H,1H3,(H2,19,22,24) |
| InChIKey | ICIPSQUUXWJHKX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |