C16H15N5O2 — CID 67365074
6-(2,6-dimethoxy-4-pyridinyl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 67365074) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 6-(2,6-dimethoxy-4-pyridinyl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(2,6-dimethoxy-4-pyridinyl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 67365074 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 6-(2,6-dimethoxy-4-pyridinyl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | COc1cc(-c2nnc(N)nc2-c2ccccc2)cc(OC)n1 |
| InChI | InChI=1S/C16H15N5O2/c1-22-12-8-11(9-13(18-12)23-2)15-14(19-16(17)21-20-15)10-6-4-3-5-7-10/h3-9H,1-2H3,(H2,17,19,21) |
| InChIKey | BWIRCKWZMRMDQC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |