C30H20N6O12S4 — CID 122392165
3-[3-[5,6-bis(3-sulfophenyl)-1,2,4-triazin-3-yl]-6-(3-sulfophenyl)-1,2,4-triazin-5-yl]benzenesulfonic acid (PubChem CID 122392165) has the molecular formula C30H20N6O12S4 and a molecular weight of 784.79 g/mol. Its IUPAC name is 3-[3-[5,6-bis(3-sulfophenyl)-1,2,4-triazin-3-yl]-6-(3-sulfophenyl)-1,2,4-triazin-5-yl]benzenesulfonic acid.
| Compound Name | 3-[3-[5,6-bis(3-sulfophenyl)-1,2,4-triazin-3-yl]-6-(3-sulfophenyl)-1,2,4-triazin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 122392165 |
| Molecular Formula | C30H20N6O12S4 |
| Molecular Weight | 784.79 g/mol |
| Exact Mass | 784.00 |
| IUPAC Name | 3-[3-[5,6-bis(3-sulfophenyl)-1,2,4-triazin-3-yl]-6-(3-sulfophenyl)-1,2,4-triazin-5-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(-c2nnc(-c3nnc(-c4cccc(S(=O)(=O)O)c4)c(-c4cccc(S(=O)(=O)O)c4)n3)nc2-c2cccc(S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C30H20N6O12S4/c37-49(38,39)21-9-1-5-17(13-21)25-27(19-7-3-11-23(15-19)51(43,44)45)33-35-29(31-25)30-32-26(18-6-2-10-22(14-18)50(40,41)42)28(34-36-30)20-8-4-12-24(16-20)52(46,47)48/h1-16H,(H,37,38,39)(H,40,41,42)(H,43,44,45)(H,46,47,48) |
| InChIKey | ZVQVPGYCNQQDJO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 294.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.79 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|