C18H15ClO6S3 — CID 157436866
3-[4-methyl-6-(3-sulfophenyl)thiopyrylium-2-yl]benzenesulfonic acid chloride (PubChem CID 157436866) has the molecular formula C18H15ClO6S3 and a molecular weight of 458.97 g/mol. Its IUPAC name is 3-[4-methyl-6-(3-sulfophenyl)thiopyrylium-2-yl]benzenesulfonic acid chloride.
| Compound Name | 3-[4-methyl-6-(3-sulfophenyl)thiopyrylium-2-yl]benzenesulfonic acid chloride |
|---|---|
| PubChem CID | 157436866 |
| Molecular Formula | C18H15ClO6S3 |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 3-[4-methyl-6-(3-sulfophenyl)thiopyrylium-2-yl]benzenesulfonic acid chloride |
| SMILES | Cc1cc(-c2cccc(S(=O)(=O)O)c2)[s+]c(-c2cccc(S(=O)(=O)O)c2)c1.[Cl-] |
| InChI | InChI=1S/C18H14O6S3.ClH/c1-12-8-17(13-4-2-6-15(10-13)26(19,20)21)25-18(9-12)14-5-3-7-16(11-14)27(22,23)24;/h2-11H,1H3,(H-,19,20,21,22,23,24);1H |
| InChIKey | BRFCPRSUMSYRND-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|