About diazomethane;bis(3-methylbenzenesulfonic acid)
diazomethane;bis(3-methylbenzenesulfonic acid) (PubChem CID 160752493) has the molecular formula C15H18N2O6S2
and a molecular weight of 386.45 g/mol. Its IUPAC name is diazomethane;bis(3-methylbenzenesulfonic acid).
Molecular Properties
| Compound Name | diazomethane;bis(3-methylbenzenesulfonic acid) |
| PubChem CID | 160752493 |
| Molecular Formula | C15H18N2O6S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | diazomethane;bis(3-methylbenzenesulfonic acid) |
| SMILES | C=[N+]=[N-].Cc1cccc(S(=O)(=O)O)c1.Cc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/2C7H8O3S.CH2N2/c2*1-6-3-2-4-7(5-6)11(8,9)10;1-3-2/h2*2-5H,1H3,(H,8,9,10);1H2 |
| InChIKey | RWZYHUUWUAURFR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 145.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze diazomethane;bis(3-methylbenzenesulfonic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazomethane;bis(3-methylbenzenesulfonic acid)?
The IUPAC name of diazomethane;bis(3-methylbenzenesulfonic acid) (CID 160752493) is diazomethane;bis(3-methylbenzenesulfonic acid).
What is the SMILES notation for diazomethane;bis(3-methylbenzenesulfonic acid)?
The canonical SMILES for diazomethane;bis(3-methylbenzenesulfonic acid) is C=[N+]=[N-].Cc1cccc(S(=O)(=O)O)c1.Cc1cccc(S(=O)(=O)O)c1.
What is the InChIKey of diazomethane;bis(3-methylbenzenesulfonic acid)?
The InChIKey is RWZYHUUWUAURFR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8O3S.CH2N2/c2*1-6-3-2-4-7(5-6)11(8,9)10;1-3-2/h2*2-5H,1H3,(H,8,9,10);1H2.
What are the key properties of diazomethane;bis(3-methylbenzenesulfonic acid)?
diazomethane;bis(3-methylbenzenesulfonic acid) has a molecular weight of 386.45 g/mol, XLogP of 2.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazomethane;bis(3-methylbenzenesulfonic acid) is sourced from PubChem (CID 160752493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).