C18H23NO3S — CID 174770364
3-methylbenzenesulfonic acid;1-phenylpiperidine (PubChem CID 174770364) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 3-methylbenzenesulfonic acid;1-phenylpiperidine.
| Compound Name | 3-methylbenzenesulfonic acid;1-phenylpiperidine |
|---|---|
| PubChem CID | 174770364 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-methylbenzenesulfonic acid;1-phenylpiperidine |
| SMILES | Cc1cccc(S(=O)(=O)O)c1.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C7H8O3S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-6-3-2-4-7(5-6)11(8,9)10/h1,3-4,7-8H,2,5-6,9-10H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | RNAFWHTVCZIVMP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|