C14H10N4O2S2 — CID 122479723
5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-2H-triazole-4-carbonitrile (PubChem CID 122479723) has the molecular formula C14H10N4O2S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122479723 |
| Molecular Formula | C14H10N4O2S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 5-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-2H-triazole-4-carbonitrile |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(-c3n[nH]nc3C#N)s2)c1 |
| InChI | InChI=1S/C14H10N4O2S2/c1-22(19,20)10-4-2-3-9(7-10)12-5-6-13(21-12)14-11(8-15)16-18-17-14/h2-7H,1H3,(H,16,17,18) |
| InChIKey | RDNYLSOLCJGJFG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |