C14H11N5S2 — CID 170148104
5-[5-[4-(methylsulfanylamino)phenyl]thiophen-2-yl]-2H-triazole-4-carbonitrile (PubChem CID 170148104) has the molecular formula C14H11N5S2 and a molecular weight of 313.41 g/mol. Its IUPAC name is 5-[5-[4-(methylsulfanylamino)phenyl]thiophen-2-yl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[5-[4-(methylsulfanylamino)phenyl]thiophen-2-yl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 170148104 |
| Molecular Formula | C14H11N5S2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 5-[5-[4-(methylsulfanylamino)phenyl]thiophen-2-yl]-2H-triazole-4-carbonitrile |
| SMILES | CSNc1ccc(-c2ccc(-c3n[nH]nc3C#N)s2)cc1 |
| InChI | InChI=1S/C14H11N5S2/c1-20-18-10-4-2-9(3-5-10)12-6-7-13(21-12)14-11(8-15)16-19-17-14/h2-7,18H,1H3,(H,16,17,19) |
| InChIKey | JBUDNVDURBLTPM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|