C13H7ClN4OS — CID 122478691
5-[5-(4-chlorophenoxy)thiophen-2-yl]-2H-triazole-4-carbonitrile (PubChem CID 122478691) has the molecular formula C13H7ClN4OS and a molecular weight of 302.75 g/mol. Its IUPAC name is 5-[5-(4-chlorophenoxy)thiophen-2-yl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[5-(4-chlorophenoxy)thiophen-2-yl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122478691 |
| Molecular Formula | C13H7ClN4OS |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 5-[5-(4-chlorophenoxy)thiophen-2-yl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1ccc(Oc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H7ClN4OS/c14-8-1-3-9(4-2-8)19-12-6-5-11(20-12)13-10(7-15)16-18-17-13/h1-6H,(H,16,17,18) |
| InChIKey | YFCZWYNLFOVBQM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |