About 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile
5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile (PubChem CID 122479044) has the molecular formula C16H8ClN5S
and a molecular weight of 337.80 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile |
| PubChem CID | 122479044 |
| Molecular Formula | C16H8ClN5S |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1ccc2nc(-c3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C16H8ClN5S/c17-11-4-1-9(2-5-11)16-19-12-6-3-10(7-14(12)23-16)15-13(8-18)20-22-21-15/h1-7H,(H,20,21,22) |
| InChIKey | GIOUINQAGABFFL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile (CID 122479044) is 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile is N#Cc1n[nH]nc1-c1ccc2nc(-c3ccc(Cl)cc3)sc2c1.
What is the InChIKey of 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile?
The InChIKey is GIOUINQAGABFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8ClN5S/c17-11-4-1-9(2-5-11)16-19-12-6-3-10(7-14(12)23-16)15-13(8-18)20-22-21-15/h1-7H,(H,20,21,22).
What are the key properties of 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile?
5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile has a molecular weight of 337.80 g/mol, XLogP of 4.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-chlorophenyl)-1,3-benzothiazol-6-yl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 122479044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).