C18H11ClN4S — CID 122477845
5-[3-(5-chloro-3-methyl-1-benzothiophen-2-yl)phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122477845) has the molecular formula C18H11ClN4S and a molecular weight of 350.83 g/mol. Its IUPAC name is 5-[3-(5-chloro-3-methyl-1-benzothiophen-2-yl)phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-(5-chloro-3-methyl-1-benzothiophen-2-yl)phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122477845 |
| Molecular Formula | C18H11ClN4S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 5-[3-(5-chloro-3-methyl-1-benzothiophen-2-yl)phenyl]-2H-triazole-4-carbonitrile |
| SMILES | Cc1c(-c2cccc(-c3n[nH]nc3C#N)c2)sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H11ClN4S/c1-10-14-8-13(19)5-6-16(14)24-18(10)12-4-2-3-11(7-12)17-15(9-20)21-23-22-17/h2-8H,1H3,(H,21,22,23) |
| InChIKey | LATUAFXKBQRHIG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |