C14H10N6O — CID 122478071
5-[3-(6-methoxypyridazin-3-yl)phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122478071) has the molecular formula C14H10N6O and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-[3-(6-methoxypyridazin-3-yl)phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-(6-methoxypyridazin-3-yl)phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122478071 |
| Molecular Formula | C14H10N6O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 5-[3-(6-methoxypyridazin-3-yl)phenyl]-2H-triazole-4-carbonitrile |
| SMILES | COc1ccc(-c2cccc(-c3n[nH]nc3C#N)c2)nn1 |
| InChI | InChI=1S/C14H10N6O/c1-21-13-6-5-11(16-18-13)9-3-2-4-10(7-9)14-12(8-15)17-20-19-14/h2-7H,1H3,(H,17,19,20) |
| InChIKey | RBMGUKIQFIDGTR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |