C18H14N4O — CID 122477715
5-[3-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122477715) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is 5-[3-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122477715 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 5-[3-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | COc1cccc(/C=C/c2cccc(-c3n[nH]nc3C#N)c2)c1 |
| InChI | InChI=1S/C18H14N4O/c1-23-16-7-3-5-14(11-16)9-8-13-4-2-6-15(10-13)18-17(12-19)20-22-21-18/h2-11H,1H3,(H,20,21,22)/b9-8+ |
| InChIKey | MNOSZBXMHRNFKX-CMDGGOBGSA-N |
| XLogP | 3.52 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|