C17H10N4O — CID 122479316
5-[3-(1-benzofuran-5-yl)phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122479316) has the molecular formula C17H10N4O and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-[3-(1-benzofuran-5-yl)phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-(1-benzofuran-5-yl)phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122479316 |
| Molecular Formula | C17H10N4O |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 5-[3-(1-benzofuran-5-yl)phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cccc(-c2ccc3occc3c2)c1 |
| InChI | InChI=1S/C17H10N4O/c18-10-15-17(20-21-19-15)14-3-1-2-11(9-14)12-4-5-16-13(8-12)6-7-22-16/h1-9H,(H,19,20,21) |
| InChIKey | MFHVUGSVRURGME-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |