C16H10F3N5 — CID 122447313
5-[4-amino-3-[3-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122447313) has the molecular formula C16H10F3N5 and a molecular weight of 329.29 g/mol. Its IUPAC name is 5-[4-amino-3-[3-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[4-amino-3-[3-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122447313 |
| Molecular Formula | C16H10F3N5 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 5-[4-amino-3-[3-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1ccc(N)c(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H10F3N5/c17-16(18,19)11-3-1-2-9(6-11)12-7-10(4-5-13(12)21)15-14(8-20)22-24-23-15/h1-7H,21H2,(H,22,23,24) |
| InChIKey | JWYHGAHTLGQSCK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|