C20H18F3N5 — CID 122477670
5-[4-(diethylamino)-3-[3-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122477670) has the molecular formula C20H18F3N5 and a molecular weight of 385.39 g/mol. Its IUPAC name is 5-[4-(diethylamino)-3-[3-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[4-(diethylamino)-3-[3-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122477670 |
| Molecular Formula | C20H18F3N5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 5-[4-(diethylamino)-3-[3-(trifluoromethyl)phenyl]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | CCN(CC)c1ccc(-c2n[nH]nc2C#N)cc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F3N5/c1-3-28(4-2)18-9-8-14(19-17(12-24)25-27-26-19)11-16(18)13-6-5-7-15(10-13)20(21,22)23/h5-11H,3-4H2,1-2H3,(H,25,26,27) |
| InChIKey | FNVLFKPOUWDUPS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |