C18H10F3N5 — CID 122478931
5-[1-[3-(trifluoromethyl)phenyl]indol-6-yl]-2H-triazole-4-carbonitrile (PubChem CID 122478931) has the molecular formula C18H10F3N5 and a molecular weight of 353.31 g/mol. Its IUPAC name is 5-[1-[3-(trifluoromethyl)phenyl]indol-6-yl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[1-[3-(trifluoromethyl)phenyl]indol-6-yl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122478931 |
| Molecular Formula | C18H10F3N5 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-[1-[3-(trifluoromethyl)phenyl]indol-6-yl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1ccc2ccn(-c3cccc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C18H10F3N5/c19-18(20,21)13-2-1-3-14(9-13)26-7-6-11-4-5-12(8-16(11)26)17-15(10-22)23-25-24-17/h1-9H,(H,23,24,25) |
| InChIKey | ICBIBXJLEOBUNJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |