C17H8F3N5S — CID 122478908
5-[6-[5-(trifluoromethyl)-1-benzothiophen-2-yl]-2-pyridinyl]-2H-triazole-4-carbonitrile (PubChem CID 122478908) has the molecular formula C17H8F3N5S and a molecular weight of 371.35 g/mol. Its IUPAC name is 5-[6-[5-(trifluoromethyl)-1-benzothiophen-2-yl]-2-pyridinyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[6-[5-(trifluoromethyl)-1-benzothiophen-2-yl]-2-pyridinyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122478908 |
| Molecular Formula | C17H8F3N5S |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 5-[6-[5-(trifluoromethyl)-1-benzothiophen-2-yl]-2-pyridinyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cccc(-c2cc3cc(C(F)(F)F)ccc3s2)n1 |
| InChI | InChI=1S/C17H8F3N5S/c18-17(19,20)10-4-5-14-9(6-10)7-15(26-14)11-2-1-3-12(22-11)16-13(8-21)23-25-24-16/h1-7H,(H,23,24,25) |
| InChIKey | OXYNHNJRFMMTSZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |