C18H13F3N4 — CID 122477555
5-[3-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122477555) has the molecular formula C18H13F3N4 and a molecular weight of 342.32 g/mol. Its IUPAC name is 5-[3-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122477555 |
| Molecular Formula | C18H13F3N4 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 5-[3-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | Cc1cc(Cc2cccc(C(F)(F)F)c2)cc(-c2n[nH]nc2C#N)c1 |
| InChI | InChI=1S/C18H13F3N4/c1-11-5-13(7-12-3-2-4-15(9-12)18(19,20)21)8-14(6-11)17-16(10-22)23-25-24-17/h2-6,8-9H,7H2,1H3,(H,23,24,25) |
| InChIKey | LSMFBIWROMXIHE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |