C17H11F3N4O — CID 122477346
5-[3-benzyl-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122477346) has the molecular formula C17H11F3N4O and a molecular weight of 344.30 g/mol. Its IUPAC name is 5-[3-benzyl-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-benzyl-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122477346 |
| Molecular Formula | C17H11F3N4O |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 5-[3-benzyl-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cc(Cc2ccccc2)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H11F3N4O/c18-17(19,20)25-14-8-12(6-11-4-2-1-3-5-11)7-13(9-14)16-15(10-21)22-24-23-16/h1-5,7-9H,6H2,(H,22,23,24) |
| InChIKey | VQEANSFGEULULP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |