C14H13F3N4O — CID 122477329
5-[3-methyl-5-(4,4,4-trifluorobutoxy)phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122477329) has the molecular formula C14H13F3N4O and a molecular weight of 310.28 g/mol. Its IUPAC name is 5-[3-methyl-5-(4,4,4-trifluorobutoxy)phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-methyl-5-(4,4,4-trifluorobutoxy)phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122477329 |
| Molecular Formula | C14H13F3N4O |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-[3-methyl-5-(4,4,4-trifluorobutoxy)phenyl]-2H-triazole-4-carbonitrile |
| SMILES | Cc1cc(OCCCC(F)(F)F)cc(-c2n[nH]nc2C#N)c1 |
| InChI | InChI=1S/C14H13F3N4O/c1-9-5-10(13-12(8-18)19-21-20-13)7-11(6-9)22-4-2-3-14(15,16)17/h5-7H,2-4H2,1H3,(H,19,20,21) |
| InChIKey | DMAUVOQMJOJBBX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|