C12H12N4 — CID 131865449
5-(2,4,6-trimethylphenyl)-2H-triazole-4-carbonitrile (PubChem CID 131865449) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 5-(2,4,6-trimethylphenyl)-2H-triazole-4-carbonitrile.
| Compound Name | 5-(2,4,6-trimethylphenyl)-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 131865449 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-(2,4,6-trimethylphenyl)-2H-triazole-4-carbonitrile |
| SMILES | Cc1cc(C)c(-c2n[nH]nc2C#N)c(C)c1 |
| InChI | InChI=1S/C12H12N4/c1-7-4-8(2)11(9(3)5-7)12-10(6-13)14-16-15-12/h4-5H,1-3H3,(H,14,15,16) |
| InChIKey | ZNWJPPKYVJSYEN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |