C11H10N4O3 — CID 170147558
5-(4-hydroxy-2,5-dimethoxyphenyl)-2H-triazole-4-carbonitrile (PubChem CID 170147558) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 5-(4-hydroxy-2,5-dimethoxyphenyl)-2H-triazole-4-carbonitrile.
| Compound Name | 5-(4-hydroxy-2,5-dimethoxyphenyl)-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 170147558 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 5-(4-hydroxy-2,5-dimethoxyphenyl)-2H-triazole-4-carbonitrile |
| SMILES | COc1cc(-c2n[nH]nc2C#N)c(OC)cc1O |
| InChI | InChI=1S/C11H10N4O3/c1-17-9-4-8(16)10(18-2)3-6(9)11-7(5-12)13-15-14-11/h3-4,16H,1-2H3,(H,13,14,15) |
| InChIKey | QTXZGPYNOJCPSS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |