C18H14N4 — CID 122477685
5-[3-methyl-5-[(E)-2-phenylethenyl]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122477685) has the molecular formula C18H14N4 and a molecular weight of 286.34 g/mol. Its IUPAC name is 5-[3-methyl-5-[(E)-2-phenylethenyl]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-methyl-5-[(E)-2-phenylethenyl]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122477685 |
| Molecular Formula | C18H14N4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 5-[3-methyl-5-[(E)-2-phenylethenyl]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | Cc1cc(/C=C/c2ccccc2)cc(-c2n[nH]nc2C#N)c1 |
| InChI | InChI=1S/C18H14N4/c1-13-9-15(8-7-14-5-3-2-4-6-14)11-16(10-13)18-17(12-19)20-22-21-18/h2-11H,1H3,(H,20,21,22)/b8-7+ |
| InChIKey | BFSJWEUKJRLYIV-BQYQJAHWSA-N |
| XLogP | 3.82 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|