C22H16N4O — CID 141428072
5-[4-[2-(2-methoxynaphthalen-1-yl)ethenyl]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 141428072) has the molecular formula C22H16N4O and a molecular weight of 352.40 g/mol. Its IUPAC name is 5-[4-[2-(2-methoxynaphthalen-1-yl)ethenyl]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[4-[2-(2-methoxynaphthalen-1-yl)ethenyl]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 141428072 |
| Molecular Formula | C22H16N4O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 5-[4-[2-(2-methoxynaphthalen-1-yl)ethenyl]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | COc1ccc2ccccc2c1C=Cc1ccc(-c2n[nH]nc2C#N)cc1 |
| InChI | InChI=1S/C22H16N4O/c1-27-21-13-11-16-4-2-3-5-18(16)19(21)12-8-15-6-9-17(10-7-15)22-20(14-23)24-26-25-22/h2-13H,1H3,(H,24,25,26) |
| InChIKey | LSWGMQSJROEYEZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|