C17H11ClN4 — CID 122447293
5-[4-[(E)-2-(4-chlorophenyl)ethenyl]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122447293) has the molecular formula C17H11ClN4 and a molecular weight of 306.76 g/mol. Its IUPAC name is 5-[4-[(E)-2-(4-chlorophenyl)ethenyl]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[4-[(E)-2-(4-chlorophenyl)ethenyl]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122447293 |
| Molecular Formula | C17H11ClN4 |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5-[4-[(E)-2-(4-chlorophenyl)ethenyl]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1ccc(/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H11ClN4/c18-15-9-5-13(6-10-15)2-1-12-3-7-14(8-4-12)17-16(11-19)20-22-21-17/h1-10H,(H,20,21,22)/b2-1+ |
| InChIKey | UJBUZMXKCBBEFI-OWOJBTEDSA-N |
| XLogP | 4.17 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|