C19H14F3N5O2S — CID 154068622
N-[4-(5-cyano-2H-triazol-4-yl)-2-[2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]methanesulfonamide (PubChem CID 154068622) has the molecular formula C19H14F3N5O2S and a molecular weight of 433.42 g/mol. Its IUPAC name is N-[4-(5-cyano-2H-triazol-4-yl)-2-[2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-(5-cyano-2H-triazol-4-yl)-2-[2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 154068622 |
| Molecular Formula | C19H14F3N5O2S |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-[4-(5-cyano-2H-triazol-4-yl)-2-[2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2n[nH]nc2C#N)cc1C=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F3N5O2S/c1-30(28,29)26-16-8-7-14(18-17(11-23)24-27-25-18)10-13(16)6-5-12-3-2-4-15(9-12)19(20,21)22/h2-10,26H,1H3,(H,24,25,27) |
| InChIKey | HOFIHJOBVQSSEF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|