C21H18F2N3P — CID 146557237
[3-(1,1-difluoroethyl)-5-[(Z)-2-[3-(5-ethynyl-2H-triazol-4-yl)phenyl]ethenyl]phenyl]methylphosphane (PubChem CID 146557237) has the molecular formula C21H18F2N3P and a molecular weight of 381.37 g/mol. Its IUPAC name is [3-(1,1-difluoroethyl)-5-[(Z)-2-[3-(5-ethynyl-2H-triazol-4-yl)phenyl]ethenyl]phenyl]methylphosphane.
| Compound Name | [3-(1,1-difluoroethyl)-5-[(Z)-2-[3-(5-ethynyl-2H-triazol-4-yl)phenyl]ethenyl]phenyl]methylphosphane |
|---|---|
| PubChem CID | 146557237 |
| Molecular Formula | C21H18F2N3P |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [3-(1,1-difluoroethyl)-5-[(Z)-2-[3-(5-ethynyl-2H-triazol-4-yl)phenyl]ethenyl]phenyl]methylphosphane |
| SMILES | C#Cc1n[nH]nc1-c1cccc(/C=C\c2cc(CP)cc(C(C)(F)F)c2)c1 |
| InChI | InChI=1S/C21H18F2N3P/c1-3-19-20(25-26-24-19)17-6-4-5-14(10-17)7-8-15-9-16(13-27)12-18(11-15)21(2,22)23/h1,4-12H,13,27H2,2H3,(H,24,25,26)/b8-7- |
| InChIKey | ZBPSDMIIDLSVMT-FPLPWBNLSA-N |
| XLogP | 5.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|