C14H7F3N6O — CID 137146927
5-[6-oxo-2-[4-(trifluoromethyl)phenyl]-1H-pyrimidin-4-yl]-2H-triazole-4-carbonitrile (PubChem CID 137146927) has the molecular formula C14H7F3N6O and a molecular weight of 332.25 g/mol. Its IUPAC name is 5-[6-oxo-2-[4-(trifluoromethyl)phenyl]-1H-pyrimidin-4-yl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[6-oxo-2-[4-(trifluoromethyl)phenyl]-1H-pyrimidin-4-yl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 137146927 |
| Molecular Formula | C14H7F3N6O |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 5-[6-oxo-2-[4-(trifluoromethyl)phenyl]-1H-pyrimidin-4-yl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cc(=O)[nH]c(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C14H7F3N6O/c15-14(16,17)8-3-1-7(2-4-8)13-19-9(5-11(24)20-13)12-10(6-18)21-23-22-12/h1-5H,(H,19,20,24)(H,21,22,23) |
| InChIKey | IPMHVJLMTAICEO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |