C15H8ClF3N4 — CID 68520851
2-(chloromethyl)-6-[3-(trifluoromethyl)phenyl]-1H-imidazo[4,5-c]pyridine-4-carbonitrile (PubChem CID 68520851) has the molecular formula C15H8ClF3N4 and a molecular weight of 336.70 g/mol. Its IUPAC name is 2-(chloromethyl)-6-[3-(trifluoromethyl)phenyl]-1H-imidazo[4,5-c]pyridine-4-carbonitrile.
| Compound Name | 2-(chloromethyl)-6-[3-(trifluoromethyl)phenyl]-1H-imidazo[4,5-c]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 68520851 |
| Molecular Formula | C15H8ClF3N4 |
| Molecular Weight | 336.70 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-(chloromethyl)-6-[3-(trifluoromethyl)phenyl]-1H-imidazo[4,5-c]pyridine-4-carbonitrile |
| SMILES | N#Cc1nc(-c2cccc(C(F)(F)F)c2)cc2[nH]c(CCl)nc12 |
| InChI | InChI=1S/C15H8ClF3N4/c16-6-13-22-11-5-10(21-12(7-20)14(11)23-13)8-2-1-3-9(4-8)15(17,18)19/h1-5H,6H2,(H,22,23) |
| InChIKey | UDVAEMBFSYHDNZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|