C17H14N4O3S — CID 122479650
5-[3-[(4-methylsulfonylphenyl)methoxy]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122479650) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 5-[3-[(4-methylsulfonylphenyl)methoxy]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-[(4-methylsulfonylphenyl)methoxy]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122479650 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 5-[3-[(4-methylsulfonylphenyl)methoxy]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | CS(=O)(=O)c1ccc(COc2cccc(-c3n[nH]nc3C#N)c2)cc1 |
| InChI | InChI=1S/C17H14N4O3S/c1-25(22,23)15-7-5-12(6-8-15)11-24-14-4-2-3-13(9-14)17-16(10-18)19-21-20-17/h2-9H,11H2,1H3,(H,19,20,21) |
| InChIKey | YHRZBNRVATYRDK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |