C20H16N6O — CID 122479682
5-[3-[(1-benzylpyrazol-4-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122479682) has the molecular formula C20H16N6O and a molecular weight of 356.39 g/mol. Its IUPAC name is 5-[3-[(1-benzylpyrazol-4-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-[(1-benzylpyrazol-4-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122479682 |
| Molecular Formula | C20H16N6O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 5-[3-[(1-benzylpyrazol-4-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cccc(OCc2cnn(Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H16N6O/c21-10-19-20(24-25-23-19)17-7-4-8-18(9-17)27-14-16-11-22-26(13-16)12-15-5-2-1-3-6-15/h1-9,11,13H,12,14H2,(H,23,24,25) |
| InChIKey | MFMPOIGCLCXRCX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |