About 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile
5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122479642) has the molecular formula C15H14N6O
and a molecular weight of 294.32 g/mol. Its IUPAC name is 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile |
| PubChem CID | 122479642 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | Cc1cc(COc2cccc(-c3n[nH]nc3C#N)c2)nn1C |
| InChI | InChI=1S/C15H14N6O/c1-10-6-12(19-21(10)2)9-22-13-5-3-4-11(7-13)15-14(8-16)17-20-18-15/h3-7H,9H2,1-2H3,(H,17,18,20) |
| InChIKey | RDNSRHHZYAEIBS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile (CID 122479642) is 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile is Cc1cc(COc2cccc(-c3n[nH]nc3C#N)c2)nn1C.
What is the InChIKey of 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile?
The InChIKey is RDNSRHHZYAEIBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N6O/c1-10-6-12(19-21(10)2)9-22-13-5-3-4-11(7-13)15-14(8-16)17-20-18-15/h3-7H,9H2,1-2H3,(H,17,18,20).
What are the key properties of 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile?
5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile has a molecular weight of 294.32 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(1,5-dimethylpyrazol-3-yl)methoxy]phenyl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 122479642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).