C21H19FN2O6S2 — CID 68922845
(E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-4-pyridin-3-ylsulfonylthiophen-2-yl]-N-methylmethanamine (PubChem CID 68922845) has the molecular formula C21H19FN2O6S2 and a molecular weight of 478.52 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-4-pyridin-3-ylsulfonylthiophen-2-yl]-N-methylmethanamine.
| Compound Name | (E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-4-pyridin-3-ylsulfonylthiophen-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 68922845 |
| Molecular Formula | C21H19FN2O6S2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-4-pyridin-3-ylsulfonylthiophen-2-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(S(=O)(=O)c2cccnc2)c(-c2ccccc2F)s1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H15FN2O2S2.C4H4O4/c1-19-10-12-9-16(24(21,22)13-5-4-8-20-11-13)17(23-12)14-6-2-3-7-15(14)18;5-3(6)1-2-4(7)8/h2-9,11,19H,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IFPLYSAMMDQSJJ-WLHGVMLRSA-N |
| XLogP | 3.21 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|