C16H15FN4O2S — CID 25234875
1-[1-(2-fluorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]-N-methylmethanamine (PubChem CID 25234875) has the molecular formula C16H15FN4O2S and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-[1-(2-fluorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(2-fluorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 25234875 |
| Molecular Formula | C16H15FN4O2S |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[1-(2-fluorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(S(=O)(=O)c2cccnc2)n(-c2ccccc2F)n1 |
| InChI | InChI=1S/C16H15FN4O2S/c1-18-10-12-9-16(24(22,23)13-5-4-8-19-11-13)21(20-12)15-7-3-2-6-14(15)17/h2-9,11,18H,10H2,1H3 |
| InChIKey | WSRDLNUEFCNMCL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |