C16H16ClFN4O2S — CID 68747712
1-[5-(benzenesulfonyl)-1-(2-fluoro-3-pyridinyl)pyrazol-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 68747712) has the molecular formula C16H16ClFN4O2S and a molecular weight of 382.85 g/mol. Its IUPAC name is 1-[5-(benzenesulfonyl)-1-(2-fluoro-3-pyridinyl)pyrazol-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[5-(benzenesulfonyl)-1-(2-fluoro-3-pyridinyl)pyrazol-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 68747712 |
| Molecular Formula | C16H16ClFN4O2S |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 1-[5-(benzenesulfonyl)-1-(2-fluoro-3-pyridinyl)pyrazol-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCc1cc(S(=O)(=O)c2ccccc2)n(-c2cccnc2F)n1.Cl |
| InChI | InChI=1S/C16H15FN4O2S.ClH/c1-18-11-12-10-15(24(22,23)13-6-3-2-4-7-13)21(20-12)14-8-5-9-19-16(14)17;/h2-10,18H,11H2,1H3;1H |
| InChIKey | VPXFGZYLLCSISX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|