C21H19F2N3O6S — CID 68748460
1-[5-(benzenesulfonyl)-1-(2,6-difluorophenyl)pyrazol-3-yl]-N-methylmethanamine;but-2-enedioic acid (PubChem CID 68748460) has the molecular formula C21H19F2N3O6S and a molecular weight of 479.46 g/mol. Its IUPAC name is 1-[5-(benzenesulfonyl)-1-(2,6-difluorophenyl)pyrazol-3-yl]-N-methylmethanamine;but-2-enedioic acid.
| Compound Name | 1-[5-(benzenesulfonyl)-1-(2,6-difluorophenyl)pyrazol-3-yl]-N-methylmethanamine;but-2-enedioic acid |
|---|---|
| PubChem CID | 68748460 |
| Molecular Formula | C21H19F2N3O6S |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 1-[5-(benzenesulfonyl)-1-(2,6-difluorophenyl)pyrazol-3-yl]-N-methylmethanamine;but-2-enedioic acid |
| SMILES | CNCc1cc(S(=O)(=O)c2ccccc2)n(-c2c(F)cccc2F)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H15F2N3O2S.C4H4O4/c1-20-11-12-10-16(25(23,24)13-6-3-2-4-7-13)22(21-12)17-14(18)8-5-9-15(17)19;5-3(6)1-2-4(7)8/h2-10,20H,11H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | QTELOPMKQAJGLP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|