C17H15ClN4O4S — CID 68922594
2-[1-(2-chlorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]ethylcarbamic acid (PubChem CID 68922594) has the molecular formula C17H15ClN4O4S and a molecular weight of 406.85 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]ethylcarbamic acid.
| Compound Name | 2-[1-(2-chlorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 68922594 |
| Molecular Formula | C17H15ClN4O4S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 2-[1-(2-chlorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]ethylcarbamic acid |
| SMILES | O=C(O)NCCc1cc(S(=O)(=O)c2cccnc2)n(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C17H15ClN4O4S/c18-14-5-1-2-6-15(14)22-16(10-12(21-22)7-9-20-17(23)24)27(25,26)13-4-3-8-19-11-13/h1-6,8,10-11,20H,7,9H2,(H,23,24) |
| InChIKey | ZVHSUDBTLCDSTM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |