C18H16ClFN4O4S — CID 87624928
2-[5-[(6-chloro-3-pyridinyl)sulfonyl]-1-(3-fluoro-2-methylphenyl)pyrazol-3-yl]ethylcarbamic acid (PubChem CID 87624928) has the molecular formula C18H16ClFN4O4S and a molecular weight of 438.87 g/mol. Its IUPAC name is 2-[5-[(6-chloro-3-pyridinyl)sulfonyl]-1-(3-fluoro-2-methylphenyl)pyrazol-3-yl]ethylcarbamic acid.
| Compound Name | 2-[5-[(6-chloro-3-pyridinyl)sulfonyl]-1-(3-fluoro-2-methylphenyl)pyrazol-3-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 87624928 |
| Molecular Formula | C18H16ClFN4O4S |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2-[5-[(6-chloro-3-pyridinyl)sulfonyl]-1-(3-fluoro-2-methylphenyl)pyrazol-3-yl]ethylcarbamic acid |
| SMILES | Cc1c(F)cccc1-n1nc(CCNC(=O)O)cc1S(=O)(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C18H16ClFN4O4S/c1-11-14(20)3-2-4-15(11)24-17(9-12(23-24)7-8-21-18(25)26)29(27,28)13-5-6-16(19)22-10-13/h2-6,9-10,21H,7-8H2,1H3,(H,25,26) |
| InChIKey | IQKSTZAHGIRSLB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|