C17H14ClN3O4S2 — CID 87624081
2-[5-(2-chloro-3-pyridinyl)-4-pyridin-3-ylsulfonylthiophen-2-yl]ethylcarbamic acid (PubChem CID 87624081) has the molecular formula C17H14ClN3O4S2 and a molecular weight of 423.90 g/mol. Its IUPAC name is 2-[5-(2-chloro-3-pyridinyl)-4-pyridin-3-ylsulfonylthiophen-2-yl]ethylcarbamic acid.
| Compound Name | 2-[5-(2-chloro-3-pyridinyl)-4-pyridin-3-ylsulfonylthiophen-2-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 87624081 |
| Molecular Formula | C17H14ClN3O4S2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 2-[5-(2-chloro-3-pyridinyl)-4-pyridin-3-ylsulfonylthiophen-2-yl]ethylcarbamic acid |
| SMILES | O=C(O)NCCc1cc(S(=O)(=O)c2cccnc2)c(-c2cccnc2Cl)s1 |
| InChI | InChI=1S/C17H14ClN3O4S2/c18-16-13(4-2-7-20-16)15-14(9-11(26-15)5-8-21-17(22)23)27(24,25)12-3-1-6-19-10-12/h1-4,6-7,9-10,21H,5,8H2,(H,22,23) |
| InChIKey | YAGYBTBPLZOVFH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|