C12H11BrN2O2S2 — CID 68925156
2-(5-bromo-4-pyridin-3-ylsulfanylthiophen-2-yl)ethylcarbamic acid (PubChem CID 68925156) has the molecular formula C12H11BrN2O2S2 and a molecular weight of 359.27 g/mol. Its IUPAC name is 2-(5-bromo-4-pyridin-3-ylsulfanylthiophen-2-yl)ethylcarbamic acid.
| Compound Name | 2-(5-bromo-4-pyridin-3-ylsulfanylthiophen-2-yl)ethylcarbamic acid |
|---|---|
| PubChem CID | 68925156 |
| Molecular Formula | C12H11BrN2O2S2 |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | 2-(5-bromo-4-pyridin-3-ylsulfanylthiophen-2-yl)ethylcarbamic acid |
| SMILES | O=C(O)NCCc1cc(Sc2cccnc2)c(Br)s1 |
| InChI | InChI=1S/C12H11BrN2O2S2/c13-11-10(18-9-2-1-4-14-7-9)6-8(19-11)3-5-15-12(16)17/h1-2,4,6-7,15H,3,5H2,(H,16,17) |
| InChIKey | JYUMDVSSFDIAQK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |