About acetic acid;3-(2-methylpropylsulfanyl)pyridine
acetic acid;3-(2-methylpropylsulfanyl)pyridine (PubChem CID 174761350) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is acetic acid;3-(2-methylpropylsulfanyl)pyridine.
Molecular Properties
| Compound Name | acetic acid;3-(2-methylpropylsulfanyl)pyridine |
| PubChem CID | 174761350 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | acetic acid;3-(2-methylpropylsulfanyl)pyridine |
| SMILES | CC(=O)O.CC(C)CSc1cccnc1 |
| InChI | InChI=1S/C9H13NS.C2H4O2/c1-8(2)7-11-9-4-3-5-10-6-9;1-2(3)4/h3-6,8H,7H2,1-2H3;1H3,(H,3,4) |
| InChIKey | FCKXMYNKVQSEMW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;3-(2-methylpropylsulfanyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-(2-methylpropylsulfanyl)pyridine?
The IUPAC name of acetic acid;3-(2-methylpropylsulfanyl)pyridine (CID 174761350) is acetic acid;3-(2-methylpropylsulfanyl)pyridine.
What is the SMILES notation for acetic acid;3-(2-methylpropylsulfanyl)pyridine?
The canonical SMILES for acetic acid;3-(2-methylpropylsulfanyl)pyridine is CC(=O)O.CC(C)CSc1cccnc1.
What is the InChIKey of acetic acid;3-(2-methylpropylsulfanyl)pyridine?
The InChIKey is FCKXMYNKVQSEMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS.C2H4O2/c1-8(2)7-11-9-4-3-5-10-6-9;1-2(3)4/h3-6,8H,7H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-(2-methylpropylsulfanyl)pyridine?
acetic acid;3-(2-methylpropylsulfanyl)pyridine has a molecular weight of 227.33 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-(2-methylpropylsulfanyl)pyridine is sourced from PubChem (CID 174761350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).