acetic acid;3-(2-methylpropylsulfanyl)pyridine

C11H17NO2S — CID 174761350

IUPACacetic acid;3-(2-methylpropylsulfanyl)pyridine
SMILESCC(=O)O.CC(C)CSc1cccnc1
InChIInChI=1S/C9H13NS.C2H4O2/c1-8(2)7-11-9-4-3-5-10-6-9;1-2(3)4/h3-6,8H,7H2,1-2H3;1H3,(H,3,4)
InChIKeyFCKXMYNKVQSEMW-UHFFFAOYSA-N
MW227.33 g/mol
LogP2.92
Rot. Bonds3

About acetic acid;3-(2-methylpropylsulfanyl)pyridine

acetic acid;3-(2-methylpropylsulfanyl)pyridine (PubChem CID 174761350) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is acetic acid;3-(2-methylpropylsulfanyl)pyridine.

Molecular Properties

Compound Nameacetic acid;3-(2-methylpropylsulfanyl)pyridine
PubChem CID174761350
Molecular FormulaC11H17NO2S
Molecular Weight227.33 g/mol
Exact Mass227.10
IUPAC Nameacetic acid;3-(2-methylpropylsulfanyl)pyridine
SMILESCC(=O)O.CC(C)CSc1cccnc1
InChIInChI=1S/C9H13NS.C2H4O2/c1-8(2)7-11-9-4-3-5-10-6-9;1-2(3)4/h3-6,8H,7H2,1-2H3;1H3,(H,3,4)
InChIKeyFCKXMYNKVQSEMW-UHFFFAOYSA-N
XLogP2.92
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.33
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze acetic acid;3-(2-methylpropylsulfanyl)pyridine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3-(2-methylpropylsulfanyl)pyridine?
The IUPAC name of acetic acid;3-(2-methylpropylsulfanyl)pyridine (CID 174761350) is acetic acid;3-(2-methylpropylsulfanyl)pyridine.
What is the SMILES notation for acetic acid;3-(2-methylpropylsulfanyl)pyridine?
The canonical SMILES for acetic acid;3-(2-methylpropylsulfanyl)pyridine is CC(=O)O.CC(C)CSc1cccnc1.
What is the InChIKey of acetic acid;3-(2-methylpropylsulfanyl)pyridine?
The InChIKey is FCKXMYNKVQSEMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS.C2H4O2/c1-8(2)7-11-9-4-3-5-10-6-9;1-2(3)4/h3-6,8H,7H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-(2-methylpropylsulfanyl)pyridine?
acetic acid;3-(2-methylpropylsulfanyl)pyridine has a molecular weight of 227.33 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-(2-methylpropylsulfanyl)pyridine is sourced from PubChem (CID 174761350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).