About S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate
S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate (PubChem CID 19871285) has the molecular formula C10H13N3OS
and a molecular weight of 223.30 g/mol. Its IUPAC name is S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate.
Molecular Properties
| Compound Name | S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate |
| PubChem CID | 19871285 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate |
| SMILES | C/C(=N\C(=O)Sc1cccnc1)N(C)C |
| InChI | InChI=1S/C10H13N3OS/c1-8(13(2)3)12-10(14)15-9-5-4-6-11-7-9/h4-7H,1-3H3/b12-8+ |
| InChIKey | FKSKIVAXIJDTGK-XYOKQWHBSA-N |
| XLogP | 2.27 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate?
The IUPAC name of S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate (CID 19871285) is S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate.
What is the SMILES notation for S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate?
The canonical SMILES for S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate is C/C(=N\C(=O)Sc1cccnc1)N(C)C.
What is the InChIKey of S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate?
The InChIKey is FKSKIVAXIJDTGK-XYOKQWHBSA-N. The full InChI is InChI=1S/C10H13N3OS/c1-8(13(2)3)12-10(14)15-9-5-4-6-11-7-9/h4-7H,1-3H3/b12-8+.
What are the key properties of S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate?
S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate has a molecular weight of 223.30 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-pyridin-3-yl (NE)-N-[1-(dimethylamino)ethylidene]carbamothioate is sourced from PubChem (CID 19871285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).