C22H20N2OS2 — CID 10453151
N-methyl-2,2-bis(phenylsulfanyl)-N-(1-pyridin-3-ylethenyl)acetamide (PubChem CID 10453151) has the molecular formula C22H20N2OS2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-methyl-2,2-bis(phenylsulfanyl)-N-(1-pyridin-3-ylethenyl)acetamide.
| Compound Name | N-methyl-2,2-bis(phenylsulfanyl)-N-(1-pyridin-3-ylethenyl)acetamide |
|---|---|
| PubChem CID | 10453151 |
| Molecular Formula | C22H20N2OS2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-methyl-2,2-bis(phenylsulfanyl)-N-(1-pyridin-3-ylethenyl)acetamide |
| SMILES | C=C(c1cccnc1)N(C)C(=O)C(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C22H20N2OS2/c1-17(18-10-9-15-23-16-18)24(2)21(25)22(26-19-11-5-3-6-12-19)27-20-13-7-4-8-14-20/h3-16,22H,1H2,2H3 |
| InChIKey | INGXVFKPPCONKS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|