C12H14N2OS2 — CID 138373803
2-(pyridine-3-carbonyl)prop-2-enyl N,N-dimethylcarbamodithioate (PubChem CID 138373803) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-(pyridine-3-carbonyl)prop-2-enyl N,N-dimethylcarbamodithioate.
| Compound Name | 2-(pyridine-3-carbonyl)prop-2-enyl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 138373803 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(pyridine-3-carbonyl)prop-2-enyl N,N-dimethylcarbamodithioate |
| SMILES | C=C(CSC(=S)N(C)C)C(=O)c1cccnc1 |
| InChI | InChI=1S/C12H14N2OS2/c1-9(8-17-12(16)14(2)3)11(15)10-5-4-6-13-7-10/h4-7H,1,8H2,2-3H3 |
| InChIKey | FWVXCNPLOSADMK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|