About pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride
pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride (PubChem CID 158425957) has the molecular formula C7H11Cl2N3S
and a molecular weight of 240.16 g/mol. Its IUPAC name is pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride.
Molecular Properties
| Compound Name | pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride |
| PubChem CID | 158425957 |
| Molecular Formula | C7H11Cl2N3S |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride |
| SMILES | C/N=C(\N)Sc1cccnc1.Cl.Cl |
| InChI | InChI=1S/C7H9N3S.2ClH/c1-9-7(8)11-6-3-2-4-10-5-6;;/h2-5H,1H3,(H2,8,9);2*1H |
| InChIKey | HBAYUAKRUGJQLM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride?
The IUPAC name of pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride (CID 158425957) is pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride.
What is the SMILES notation for pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride?
The canonical SMILES for pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride is C/N=C(\N)Sc1cccnc1.Cl.Cl.
What is the InChIKey of pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride?
The InChIKey is HBAYUAKRUGJQLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S.2ClH/c1-9-7(8)11-6-3-2-4-10-5-6;;/h2-5H,1H3,(H2,8,9);2*1H.
What are the key properties of pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride?
pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride has a molecular weight of 240.16 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-yl N'-methylcarbamimidothioate;dihydrochloride is sourced from PubChem (CID 158425957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).